For research use only. Not for therapeutic Use.
Saquinavir Mesylate（Cat No.:I001850）is an antiretroviral drug used primarily in the treatment of HIV infection. It is a potent inhibitor of the HIV-1 protease enzyme, which is essential for the replication of the virus. By inhibiting this enzyme, Saquinavir Mesylate prevents the maturation of viral particles, reducing viral load and slowing disease progression. This compound is often used in combination with other antiretroviral therapies for optimized treatment. Its high purity and specificity make it a key component in the development of effective HIV management protocols.
| Catalog Number | I001850 |
| CAS Number | 149845-06-7 |
| Synonyms | (2S)-N-[(2S,3R)-4-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]-2-(quinoline-2-carbonylamino)butanediamide;methanesulfonic acid |
| Molecular Formula | C38H50N6O5 • CH3SO3H |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (2S)-N-[(2S,3R)-4-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]-2-(quinoline-2-carbonylamino)butanediamide;methanesulfonic acid |
| InChI | InChI=1S/C38H50N6O5.CH4O3S/c1-38(2,3)43-37(49)32-20-26-14-7-8-15-27(26)22-44(32)23-33(45)30(19-24-11-5-4-6-12-24)41-36(48)31(21-34(39)46)42-35(47)29-18-17-25-13-9-10-16-28(25)40-29;1-5(2,3)4/h4-6,9-13,16-18,26-27,30-33,45H,7-8,14-15,19-23H2,1-3H3,(H2,39,46)(H,41,48)(H,42,47)(H,43,49);1H3,(H,2,3,4)/t26-,27+,30-,31-,32-,33+;/m0./s1 |
| InChIKey | IRHXGOXEBNJUSN-YOXDLBRISA-N |
| SMILES | CC(C)(C)NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2CN1C[C@H]([C@H](CC3=CC=CC=C3)NC(=O)[C@H](CC(=O)N)NC(=O)C4=NC5=CC=CC=C5C=C4)O.CS(=O)(=O)O |
| Reference | <p style=/line-height:25px/> |
