For research use only. Not for therapeutic Use.
SAR125844（Cat No.:I009283）is a highly selective small-molecule inhibitor of c-MET, a receptor tyrosine kinase involved in cell proliferation, survival, and metastasis. By inhibiting c-MET signaling, SAR125844 disrupts tumor growth and the spread of cancer, particularly in cancers with MET gene amplification or overexpression. Preclinical studies have shown its efficacy in reducing tumor cell viability and inducing apoptosis in MET-dependent cancers, such as non-small cell lung cancer (NSCLC) and gastric cancer. SAR125844 is being explored in clinical trials for its potential to improve outcomes in MET-driven malignancies.
| Catalog Number | I009283 |
| CAS Number | 1116743-46-4 |
| Synonyms | SAR125844; SAR 125844; SAR-125844;1-(6-((6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)thio)benzo[d]thiazol-2-yl)-3-(2-morpholinoethyl)urea |
| Molecular Formula | C25H23FN8O2S2 |
| Purity | ≥95% |
| Target | PI3K/Akt/mTOR |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| Overview of Clinical Research | Originator: Sanofi<br /> |
| IUPAC Name | 1-[6-[[6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]-1,3-benzothiazol-2-yl]-3-(2-morpholin-4-ylethyl)urea |
| InChI | InChI=1S/C25H23FN8O2S2/c26-17-3-1-16(2-4-17)19-7-8-22-30-31-25(34(22)32-19)37-18-5-6-20-21(15-18)38-24(28-20)29-23(35)27-9-10-33-11-13-36-14-12-33/h1-8,15H,9-14H2,(H2,27,28,29,35) |
| InChIKey | ODIUNTQOXRXOIV-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCNC(=O)NC2=NC3=C(S2)C=C(C=C3)SC4=NN=C5N4N=C(C=C5)C6=CC=C(C=C6)F |
| Reference | <br /> |
