For research use only. Not for therapeutic Use.
Sarcosine-15N(Cat No.:S000664) is a labeled variant of sarcosine where the nitrogen atom is enriched with nitrogen-15, enhancing its detectability in sensitive analytical methods such as NMR spectroscopy and mass spectrometry. Sarcosine is a derivative of glycine, known as N-methylglycine, and plays a role in one-carbon metabolism and methylation processes within the body. The enrichment makes it particularly useful for studying nitrogen metabolism and its role in health conditions like prostate cancer. This labeling allows researchers to trace and understand sarcosine’s metabolic pathways and interactions more precisely in biological systems.
Molecular Formula | C3H715NO2 |
Purity | ≥95% |
Target | Membrane Transporter/Ion Channel |
IUPAC Name | 2-(methyl(15N)amino)acetic acid |
InChI | InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6)/i4+1 |
InChIKey | FSYKKLYZXJSNPZ-AZXPZELESA-N |
SMILES | CNCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |