For research use only. Not for therapeutic Use.
Sarcosine-d3(Cat No.:S000615) is a deuterium-labeled version of sarcosine, where three hydrogen atoms are replaced with deuterium (D), enhancing its stability and detectability in analytical studies. Sarcosine, a derivative of the amino acid glycine, plays a role in methylation processes and is involved in the metabolism of choline to glycine. Sarcosine-d3 is particularly useful in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, allowing researchers to investigate sarcosine’s biochemical pathways and its potential implications in health conditions such as prostate cancer and psychiatric disorders. This isotopic labeling aids in precise metabolic tracing and research applications.
CAS Number | 118685-91-9 |
Molecular Formula | C3H4D3NO2 |
Purity | ≥95% |
IUPAC Name | 2-(trideuteriomethylamino)acetic acid |
InChI | InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6)/i1D3 |
InChIKey | FSYKKLYZXJSNPZ-FIBGUPNXSA-N |
SMILES | CNCC(=O)O |