For research use only. Not for therapeutic Use.
CAS Number | 5473-12-1 |
Synonyms | sarcosine methyl ester;Glycine, N-Methyl-, Methyl ester |
Molecular Formula | C4H9NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl 2-(methylamino)acetate |
InChI | InChI=1S/C4H9NO2/c1-5-3-4(6)7-2/h5H,3H2,1-2H3 |
InChIKey | VXGABWCSZZWXPC-UHFFFAOYSA-N |
SMILES | CNCC(=O)OC |
Reference | 1: Sener A, Dunlop ME, Gomis R, Mathias PC, Malaisse-Lagae F, Malaisse WJ. Role 2: Zhang X, Gan L, Huang S, Shi Y. Iodo-controlled selective formation of 3: Alarcon C, Valverde I, Malaisse WJ. Transglutaminase and cellular motile |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |