For research use only. Not for therapeutic Use.
Sari 59-801（Cat No.:I036017）is a selective inhibitor of the protein kinase C (PKC) family, specifically targeting the PKCθ isoform. PKCθ plays a key role in the regulation of T-cell activation and immune response. By inhibiting PKCθ, Sari 59-801 is being explored for its potential in modulating immune responses, particularly in autoimmune diseases and transplant rejection. Preclinical studies suggest it may reduce T-cell-mediated inflammation and immune activation. However, further research and clinical trials are needed to assess its safety, efficacy, and therapeutic potential in treating conditions like rheumatoid arthritis, lupus, and other immune-related disorders.
| Catalog Number | I036017 |
| CAS Number | 80565-58-8 |
| Synonyms | Sari 59-801; Sari-59-801; Sari59-801; Sari 59801; Sari-59801; Sari59801; Sandoz 59-801; Sandoz59-801; Sandoz-59-801; |
| Molecular Formula | C18H23N3O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-(dimethylamino)-1-[2-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-1H-indol-3-yl]ethanol |
| InChI | InChI=1S/C18H23N3O2/c1-5-13-16(11(2)23-20-13)18-17(15(22)10-21(3)4)12-8-6-7-9-14(12)19-18/h6-9,15,19,22H,5,10H2,1-4H3 |
| InChIKey | GMGOZCSXMVXXRS-UHFFFAOYSA-N |
| SMILES | CCC1=NOC(=C1C2=C(C3=CC=CC=C3N2)C(CN(C)C)O)C |
| Reference | 1: Hanson RL, Isaacson CM. Stimulation of insulin secretion from isolated rat islets by SaRI 59-801. Relation to cAMP concentration and Ca2+ uptake. Diabetes. 1985 Jul;34(7):691-5. PubMed PMID: 2408949. |
