For research use only. Not for therapeutic Use.
SARS-CoV-2-IN-39(CAT: I040937) is an inhibitor targeting a specific viral protein or pathway critical for the replication of the SARS-CoV-2 virus. This compound works by disrupting viral replication mechanisms, potentially targeting enzymes such as the viral protease or RNA polymerase, which are essential for the viral life cycle. By inhibiting these enzymes, SARS-CoV-2-IN-39 can reduce viral load and prevent the progression of COVID-19. This compound is highly relevant for Infection Disease Research, specifically in the development of antiviral therapies aimed at treating or preventing SARS-CoV-2 infections and combating emerging viral variants.
CAS Number | 2882823-03-0 |
Synonyms | 5-chloro-4-fluoro-2-hydroxy-N-[4-(trifluoromethoxy)phenyl]benzamide |
Molecular Formula | C14H8ClF4NO3 |
Purity | ≥95% |
IUPAC Name | 5-chloro-4-fluoro-2-hydroxy-N-[4-(trifluoromethoxy)phenyl]benzamide |
InChI | InChI=1S/C14H8ClF4NO3/c15-10-5-9(12(21)6-11(10)16)13(22)20-7-1-3-8(4-2-7)23-14(17,18)19/h1-6,21H,(H,20,22) |
InChIKey | AGOOHZQXJABZCD-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1NC(=O)C2=CC(=C(C=C2O)F)Cl)OC(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |