For research use only. Not for therapeutic Use.
SARS-CoV-2 nsp13-IN-1（Cat No.:I043328）is a small molecule inhibitor targeting the non-structural protein 13 (nsp13) of the SARS-CoV-2 virus. Nsp13 is an essential helicase involved in viral RNA replication and transcription, making it a critical target for antiviral drug development. By inhibiting nsp13, SARS-CoV-2 nsp13-IN-1 disrupts viral replication, thereby limiting the spread of the virus within host cells. This compound is being studied as a potential therapeutic option for COVID-19, offering a targeted approach to inhibit viral replication and potentially reduce disease severity and transmission in infected individuals.
| CAS Number | 1005304-44-8 |
| Synonyms | N-[4-(2-methyl-4-oxopyrido[2,3-d]pyrimidin-3-yl)phenyl]-4-phenylbenzamide |
| Molecular Formula | C27H20N4O2 |
| Purity | ≥95% |
| IUPAC Name | N-[4-(2-methyl-4-oxopyrido[2,3-d]pyrimidin-3-yl)phenyl]-4-phenylbenzamide |
| InChI | InChI=1S/C27H20N4O2/c1-18-29-25-24(8-5-17-28-25)27(33)31(18)23-15-13-22(14-16-23)30-26(32)21-11-9-20(10-12-21)19-6-3-2-4-7-19/h2-17H,1H3,(H,30,32) |
| InChIKey | YQMFYRIEVDLXHD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC=N2)C(=O)N1C3=CC=C(C=C3)NC(=O)C4=CC=C(C=C4)C5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
