For research use only. Not for therapeutic Use.
SARS-CoV-2 nsp14-IN-3(CAT: I040942) is an inhibitor targeting the nsp14 protein of the SARS-CoV-2 virus. Nsp14 is a key component of the viral RNA capping machinery, essential for viral replication and evading the host immune response. By inhibiting nsp14, this compound disrupts viral RNA capping, potentially reducing the replication efficiency of SARS-CoV-2. SARS-CoV-2 nsp14-IN-3 holds promise for use in antiviral research and the development of therapeutic strategies against COVID-19, particularly in Infection Disease Research. It represents a novel approach for targeting viral enzymes to impede the progression of SARS-CoV-2 infections.
CAS Number | 2920574-16-7 |
Synonyms | 5-formyl-4-methyl-N-[2-methyl-3-(2-oxoimidazolidin-1-yl)phenyl]thiophene-2-carboxamide |
Molecular Formula | C17H17N3O3S |
Purity | ≥95% |
IUPAC Name | 5-formyl-4-methyl-N-[2-methyl-3-(2-oxoimidazolidin-1-yl)phenyl]thiophene-2-carboxamide |
InChI | InChI=1S/C17H17N3O3S/c1-10-8-14(24-15(10)9-21)16(22)19-12-4-3-5-13(11(12)2)20-7-6-18-17(20)23/h3-5,8-9H,6-7H2,1-2H3,(H,18,23)(H,19,22) |
InChIKey | ZJRJCWRBMHUFCK-UHFFFAOYSA-N |
SMILES | CC1=C(SC(=C1)C(=O)NC2=C(C(=CC=C2)N3CCNC3=O)C)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |