For research use only. Not for therapeutic Use.
5-HT<sub>2C/2B</sub> receptor antagonist, selective over 5-HT<sub>1A</sub>. Affinities are 7.4 (pA<sub>2</sub>), 6.9 (pK<sub>i</sub>) and 5.2 (pK<sub>i</sub>) for 5-HT<sub>2B</sub>, <sub>2C</sub> and <sub>2A</sub> respectively. Orally active <em>in vivo</em>.
| Catalog Number | I010402 |
| CAS Number | 143797-62-0 |
| Synonyms | N-(1-Methyl-1H-indol-5-yl)-N/’-3-pyridinylurea |
| Molecular Formula | C15H15ClN4O |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | Store at RT |
| IUPAC Name | 1-(1-methylindol-5-yl)-3-pyridin-3-ylurea;hydrochloride |
| InChI | InChI=1S/C15H14N4O.ClH/c1-19-8-6-11-9-12(4-5-14(11)19)17-15(20)18-13-3-2-7-16-10-13;/h2-10H,1H3,(H2,17,18,20);1H |
| InChIKey | IGRYPUQJEDJLHC-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C1C=CC(=C2)NC(=O)NC3=CN=CC=C3.Cl |
