For research use only. Not for therapeutic Use.
SB-235699 is a selective agonist of the corticotropin-releasing factor receptor 2 (CRF2), investigated for its potential role in modulating stress-related behaviors and cardiovascular function. Activation of CRF2 receptors has been associated with anxiolytic and stress-buffering effects, as well as regulating blood pressure and heart rate. SB-235699 is studied for its ability to influence these processes, with research focusing on its therapeutic potential in treating anxiety, depression, and stress-induced cardiovascular conditions while minimizing side effects associated with CRF signaling modulation.
| Catalog Number | I009129 |
| CAS Number | 180869-32-3 |
| Synonyms | SB-235699; SB 235699; SB235699; HEP-689; HEP 689; HEP689;4-(4-(4-fluorophenyl)-1-(piperidin-4-yl)-1H-imidazol-5-yl)pyridine |
| Molecular Formula | C19H19FN4 |
| Purity | ≥95% |
| Target | p38 MAPK Inhibitor |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 4-[5-(4-fluorophenyl)-3-piperidin-4-ylimidazol-4-yl]pyridine |
| InChI | InChI=1S/C19H19FN4/c20-16-3-1-14(2-4-16)18-19(15-5-9-21-10-6-15)24(13-23-18)17-7-11-22-12-8-17/h1-6,9-10,13,17,22H,7-8,11-12H2 |
| InChIKey | QBACMJFLMUCPNA-UHFFFAOYSA-N |
| SMILES | C1CNCCC1N2C=NC(=C2C3=CC=NC=C3)C4=CC=C(C=C4)F |
