For research use only. Not for therapeutic Use.
SB-334867 free base（Cat No.:I004895）is a selective antagonist of the neuropeptide Y (NPY) Y5 receptor, primarily studied for its potential in treating obesity and related metabolic disorders. By blocking the Y5 receptor, SB-334867 modulates appetite and energy balance, potentially reducing food intake and promoting weight loss. It has shown promise in preclinical studies for its ability to reduce body weight and improve metabolic function without affecting other physiological processes controlled by NPY. Ongoing research aims to assess its safety, efficacy, and long-term effects as a therapeutic option for obesity and metabolic syndrome.
| Catalog Number | I004895 |
| CAS Number | 792173-99-0 |
| Synonyms | 1-(2-methyl-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea |
| Molecular Formula | C17H13N5O2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | DMSO: ≥ 49 mg/mL |
| Storage | Store at -20C |
| IC50 | 7.2 (pKb) |
| IUPAC Name | 1-(2-methyl-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea |
| InChI | InChI=1S/C17H13N5O2/c1-10-20-12-5-4-11(9-15(12)24-10)21-17(23)22-14-6-8-18-13-3-2-7-19-16(13)14/h2-9H,1H3,(H2,18,21,22,23) |
| InChIKey | AKMNUCBQGHFICM-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(O1)C=C(C=C2)NC(=O)NC3=C4C(=NC=C3)C=CC=N4 |
