For research use only. Not for therapeutic Use.
SB-525334 (CAT: I003306) is a selective and potent small molecule inhibitor of the transforming growth factor-beta (TGF-β) receptor I (ALK5). It belongs to the class of compounds known as kinase inhibitors. By targeting ALK5, SB-525334 blocks the TGF-β signaling pathway, which plays a crucial role in various cellular processes such as cell growth, differentiation, and immune response. SB-525334 has shown promising results in preclinical studies, demonstrating its potential as a therapeutic agent for fibrotic diseases and certain types of cancers. Further research and clinical trials are needed to fully evaluate its efficacy and safety in human patients.
| CAS Number | 356559-20-1 |
| Synonyms | 6-[2-tert-butyl-5-(6-methylpyridin-2-yl)-1H-imidazol-4-yl]quinoxaline |
| Molecular Formula | C₂₁H₂₁N₅ |
| Purity | ≥95% |
| Target | TGF-β Receptor |
| Solubility | 10 mM in DMSO |
| Storage | -20 ℃ |
| IC50 | 14.3 nM |
| IUPAC Name | 6-[2-tert-butyl-5-(6-methylpyridin-2-yl)-1H-imidazol-4-yl]quinoxaline |
| InChI | InChI=1S/C21H21N5/c1-13-6-5-7-16(24-13)19-18(25-20(26-19)21(2,3)4)14-8-9-15-17(12-14)23-11-10-22-15/h5-12H,1-4H3,(H,25,26) |
| InChIKey | DKPQHFZUICCZHF-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC(=N1)C2=C(N=C(N2)C(C)(C)C)C3=CC4=NC=CN=C4C=C3 |
