For research use only. Not for therapeutic Use.
SB-633825 is a small-molecule inhibitor of the insulin-like growth factor-1 receptor (IGF-1R), a protein involved in the regulation of cell growth, survival, and differentiation. Overactivation of IGF-1R is associated with the development and progression of various cancers, making it a target for anti-cancer therapies. SB-633825 is studied for its potential to block IGF-1R signaling, thereby inhibiting tumor growth and inducing apoptosis in cancer cells. Research focuses on its efficacy in treating cancers that are driven by IGF-1R overexpression.
| Catalog Number | I009347 |
| CAS Number | 956613-01-7 |
| Synonyms | 4-[5-(6-methoxynaphthalen-2-yl)-1-methyl-2-(2-methyl-4-methylsulfonylphenyl)imidazol-4-yl]pyridine |
| Molecular Formula | C28H25N3O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C28H25N3O3S/c1-18-15-24(35(4,32)33)9-10-25(18)28-30-26(19-11-13-29-14-12-19)27(31(28)2)22-6-5-21-17-23(34-3)8-7-20(21)16-22/h5-17H,1-4H3 |
| InChIKey | ZDSNJSQTPLXCSG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)C)C2=NC(=C(N2C)C3=CC4=C(C=C3)C=C(C=C4)OC)C5=CC=NC=C5 |
