For research use only. Not for therapeutic Use.
SBHA (Cat No.:R010874) is a potent histone deacetylase (HDAC) inhibitor, widely studied for its potential anticancer properties. By inhibiting HDAC activity, SBHA promotes the accumulation of acetylated histones, leading to altered gene expression and the activation of tumor suppressor genes. This process can induce cell cycle arrest, apoptosis, and differentiation in various cancer cells. SBHA has shown promise in preclinical studies for treating solid tumors and hematological malignancies. Its ability to modulate chromatin structure makes it a valuable compound in epigenetic and cancer research.
| Catalog Number | R010874 |
| CAS Number | 38937-66-5 |
| Synonyms | N1,N8-Dihydroxyoctanediamide; N,N’-Dihydroxyoctanediamide; SBHA; Suberodihydroxamic Acid; Suberic Bishydroxamate; |
| Molecular Formula | C8H16N2O4 |
| Purity | ≥95% |
| Target | HDAC |
| Solubility | >9.85mg/mL in DMSO |
| Storage | Store at 4°C |
| IUPAC Name | N,N'-dihydroxyoctanediamide |
| InChI | InChI=1S/C8H16N2O4/c11-7(9-13)5-3-1-2-4-6-8(12)10-14/h13-14H,1-6H2,(H,9,11)(H,10,12) |
| InChIKey | IDQPVOFTURLJPT-UHFFFAOYSA-N |
| SMILES | C(CCCC(=O)NO)CCC(=O)NO |
