For research use only. Not for therapeutic Use.
SC-22716(CAT: I009367) is a selective thromboxane A2 (TXA2) receptor antagonist that inhibits TXA2-mediated platelet aggregation and vasoconstriction. By blocking the binding of TXA2 to its receptor, SC-22716 plays a critical role in modulating thrombosis and vascular tone, making it highly relevant in the cardiovascular research field. This compound is widely utilized in studies focusing on platelet function, clotting disorders, and the development of anti-thrombotic therapies. Its specificity and efficacy provide valuable insights into thromboxane-related mechanisms, supporting the advancement of treatments for cardiovascular diseases.
| Catalog Number | I009367 |
| CAS Number | 262451-89-8 |
| Synonyms | SC-22716; SC 22716; SC22716.;1-[2-(4-Phenylphenoxy)ethyl]pyrrolidine |
| Molecular Formula | C18H21NO |
| Purity | ≥95% |
| Target | Aminopeptidase |
| Solubility | Soluble in DMSO |
| Storage | Store at RT |
| IUPAC Name | 1-[2-(4-phenylphenoxy)ethyl]pyrrolidine |
| InChI | InChI=1S/C18H21NO/c1-2-6-16(7-3-1)17-8-10-18(11-9-17)20-15-14-19-12-4-5-13-19/h1-3,6-11H,4-5,12-15H2 |
| InChIKey | PKUGRVAJRGZDJP-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCOC2=CC=C(C=C2)C3=CC=CC=C3 |
