For research use only. Not for therapeutic Use.
SC-68376（Cat No.:I009373）is a selective small molecule inhibitor of the protein kinase AKT, which plays a central role in regulating cell survival, growth, and metabolism. AKT is often overactive in various cancers, contributing to tumorigenesis, resistance to apoptosis, and drug resistance. By inhibiting AKT, SC-68376 has potential therapeutic applications in treating cancers, particularly those with aberrant AKT signaling, such as breast, prostate, and lung cancers. Preclinical studies have shown that SC-68376 can suppress tumor growth and sensitize cancer cells to other therapies. Further clinical testing is required to assess its safety, efficacy, and potential use in oncology.
| Catalog Number | I009373 |
| CAS Number | 318480-82-9 |
| Synonyms | SC-68376; SC 68376; SC68376.;4-(2-methyl-4-phenyl-1,3-oxazol-5-yl)pyridine |
| Molecular Formula | C15H12N2O |
| Purity | ≥95% |
| Target | p38 MAP kinase Inhibitor |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 2-methyl-4-phenyl-5-pyridin-4-yl-1,3-oxazole |
| InChI | InChI=1S/C15H12N2O/c1-11-17-14(12-5-3-2-4-6-12)15(18-11)13-7-9-16-10-8-13/h2-10H,1H3 |
| InChIKey | BHWCZLOXTLWZAQ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(O1)C2=CC=NC=C2)C3=CC=CC=C3 |
| Reference | </br>1: Kooijman R, Coppens A, Hooghe-Peters E. IGF-I stimulates IL-8 production in the promyelocytic cell line HL-60 through activation of extracellular signal-regulated protein kinase. Cell Signal. 2003 Dec;15(12):1091-8. PubMed PMID: 14575864.</br>2:Ermert M, Kuttner D, Eisenhardt N, Dierkes C, Seeger W, Ermert L. Cyclooxygenase-2-dependent and thromboxane-dependent vascular and bronchial responses are regulated via p38 mitogen-activated protein kinase in control and endotoxin-primed rat lungs. Lab Invest. 2003 Mar;83(3):333-47. PubMed PMID: 12649334. |
