For research use only. Not for therapeutic Use.
SC-III3(CAT: I009416) is a small-molecule inhibitor widely studied for its role in modulating specific signaling pathways, particularly in the context of extracellular matrix remodeling and cellular interactions. It is commonly used in research related to metalloproteinase activity, including the inhibition of enzymes like heparanase or related proteolytic enzymes, which are key in processes such as tumor metastasis and angiogenesis. With its high specificity and potency, SC-III3 is a valuable tool in cancer biology, drug discovery, and tissue engineering research. Its versatility enables detailed exploration of molecular mechanisms, providing insights into therapeutic strategies for targeting matrix-related pathologies and other cellular processes.
CAS Number | 1660110-65-5 |
Synonyms | SC-III3;(E)-3-(4-chlorophenyl)-N-(7-hydroxy-6-methoxy-2-oxo-2H-chromen-3-yl) acrylamide |
Molecular Formula | C19H14ClNO5 |
Purity | ≥95% |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | 3-(4-chlorophenyl)-N-(7-hydroxy-6-methoxy-2-oxochromen-3-yl)prop-2-enamide |
InChI | InChI=1S/C19H14ClNO5/c1-25-17-9-12-8-14(19(24)26-16(12)10-15(17)22)21-18(23)7-4-11-2-5-13(20)6-3-11/h2-10,22H,1H3,(H,21,23) |
InChIKey | AMPNDMHYLKZGFC-UHFFFAOYSA-N |
SMILES | COC1=C(C=C2C(=C1)C=C(C(=O)O2)NC(=O)C=CC3=CC=C(C=C3)Cl)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |