For research use only. Not for therapeutic Use.
SCH 32615 is a potent inhibitor of the enzyme neutral endopeptidase (NEP), which is involved in the degradation of various bioactive peptides, including enkephalins and natriuretic peptides. By inhibiting NEP, SCH 32615 enhances the levels of these peptides, leading to potential therapeutic effects in pain management, cardiovascular diseases, and other conditions where peptide regulation is beneficial. It has been studied for its role in modulating pain pathways and improving heart function, offering insights into the development of novel treatments.
| Catalog Number | I009388 |
| CAS Number | 83861-02-3 |
| Synonyms | (2S)-2-[[(2S)-1-(2-carboxyethylamino)-1-oxo-3-phenylpropan-2-yl]amino]-3-phenylpropanoic acid |
| Molecular Formula | C21H24N2O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C21H24N2O5/c24-19(25)11-12-22-20(26)17(13-15-7-3-1-4-8-15)23-18(21(27)28)14-16-9-5-2-6-10-16/h1-10,17-18,23H,11-14H2,(H,22,26)(H,24,25)(H,27,28)/t17-,18-/m0/s1 |
| InChIKey | WOVRTBFSWOVRST-ROUUACIJSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)NCCC(=O)O)NC(CC2=CC=CC=C2)C(=O)O |
