For research use only. Not for therapeutic Use.
SCH772984 (Cat No.:I005598) is a potent and selective inhibitor of mitogen-activated protein kinase (MAPK) signaling, particularly targeting extracellular signal-regulated kinase (ERK) 1/2. It inhibits the phosphorylation of ERK1/2 and disrupts downstream signaling cascades involved in cell proliferation and survival. SCH772984 has shown efficacy in preclinical models of various cancers, including melanoma, pancreatic cancer, and non-small cell lung cancer. Its selective targeting of the ERK pathway makes it a promising candidate for targeted therapy, and further studies are underway to evaluate its clinical potential in cancer treatment.
| Catalog Number | I005598 |
| CAS Number | 942183-80-4 |
| Synonyms | SCH-772984 |
| Molecular Formula | C₃₃H₃₃N₉O₂ |
| Purity | ≥95% |
| Target | MEK1/2 |
| Solubility | DMSO: ≥ 51 mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 4 nM/1 nM (ERK1/2) |
| IUPAC Name | (3R)-1-[2-oxo-2-[4-(4-pyrimidin-2-ylphenyl)piperazin-1-yl]ethyl]-N-(3-pyridin-4-yl-1H-indazol-5-yl)pyrrolidine-3-carboxamide |
| InChI | InChI=1S/C33H33N9O2/c43-30(42-18-16-41(17-19-42)27-5-2-24(3-6-27)32-35-11-1-12-36-32)22-40-15-10-25(21-40)33(44)37-26-4-7-29-28(20-26)31(39-38-29)23-8-13-34-14-9-23/h1-9,11-14,20,25H,10,15-19,21-22H2,(H,37,44)(H,38,39)/t25-/m1/s1 |
| InChIKey | HDAJDNHIBCDLQF-RUZDIDTESA-N |
| SMILES | C1CN(C[C@@H]1C(=O)NC2=CC3=C(C=C2)NN=C3C4=CC=NC=C4)CC(=O)N5CCN(CC5)C6=CC=C(C=C6)C7=NC=CC=N7 |
| Reference | <br /> |
