For research use only. Not for therapeutic Use.
Schisandrol B (Cat.No:I004182) is a bioactive lignan derived from the fruit of Schisandra chinensis, known for its adaptogenic and neuroprotective properties. It has been shown to enhance cognitive function, reduce fatigue, and promote overall vitality by modulating stress responses. Schisandrol B is also studied for its potential antioxidant and anti-inflammatory effects. This compound is used in traditional medicine for improving mental clarity and supporting the immune system, making it valuable for research in pharmacology and natural product development.
CAS Number | 58546-54-6 |
Molecular Formula | C23H28O7 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | 3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-9-ol |
InChI | InChI=1S/C23H28O7/c1-12-7-13-8-16-20(30-11-29-16)22(28-6)17(13)18-14(10-23(12,2)24)9-15(25-3)19(26-4)21(18)27-5/h8-9,12,24H,7,10-11H2,1-6H3 |
InChIKey | ZWRRJEICIPUPHZ-UHFFFAOYSA-N |
SMILES | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4CC1(C)O)OC)OC)OC)OC)OCO3 |