For research use only. Not for therapeutic Use.
Scutellarein（Cat No.:I003936）is a natural flavonoid found in plants like Scutellaria baicalensis and Erigeron breviscapus, known for its diverse pharmacological properties. It exhibits potent antioxidant, anti-inflammatory, antiviral, and anticancer activities. Scutellarein has been studied for its ability to inhibit cancer cell proliferation by inducing apoptosis and cell cycle arrest. Additionally, it shows neuroprotective effects, making it a potential candidate for treating neurodegenerative diseases. Its anti-inflammatory and antiviral properties are being explored for managing cardiovascular diseases and viral infections, positioning scutellarein as a promising compound for therapeutic development.
| Catalog Number | I003936 |
| CAS Number | 529-53-3 |
| Molecular Formula | C15H10O6 |
| Purity | ≥95% |
| Solubility | DMSO: ＞ 38 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 5,6,7-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| InChI | InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)11-5-9(17)13-12(21-11)6-10(18)14(19)15(13)20/h1-6,16,18-20H |
| InChIKey | JVXZRQGOGOXCEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C=C(C(=C3O)O)O)O |
| Reference | <p style=/line-height:25px/> <br>[2]. Xiaoxuan Tian, et al. Delineation of Platelet Activation Pathway of Scutellarein Revealed Its Intracellular Target as Protein Kinase C. Biological and Pharmaceutical Bulletin </p> |
