For research use only. Not for therapeutic Use.
Scutellarein Tetramethyl Ether(Cat No.:M049471)is a methylated flavonoid derived from scutellarein, commonly found in plants of the Scutellaria genus. Known for its potent antioxidant and anti-inflammatory properties, it is widely researched for potential therapeutic benefits in conditions associated with oxidative stress, such as cardiovascular and neurodegenerative diseases. Scutellarein Tetramethyl Ether has shown promising effects in modulating cellular pathways related to inflammation and apoptosis, making it valuable in pharmaceutical and nutraceutical applications. Additionally, its role in cancer research is emerging, particularly for its potential to inhibit tumor growth.
Catalog Number | M049471 |
CAS Number | 1168-42-9 |
Molecular Formula | C19H18O6 |
Purity | ≥95% |
Target | Bacterial |
Storage | 4°C, protect from light |
IUPAC Name | 5,6,7-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
InChI | InChI=1S/C19H18O6/c1-21-12-7-5-11(6-8-12)14-9-13(20)17-15(25-14)10-16(22-2)18(23-3)19(17)24-4/h5-10H,1-4H3 |
InChIKey | URSUMOWUGDXZHU-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)OC)OC)OC |