For research use only. Not for therapeutic Use.
Scytonemin(Cat No.:M095418)is a natural ultraviolet (UV) screening pigment produced by cyanobacteria, playing a crucial role in protecting these microorganisms from harmful UV radiation. This unique compound, characterized by its distinctive yellow-brown color, absorbs UV-A light effectively, preventing DNA damage and oxidative stress. Its high stability and bioactivity make it valuable in dermatological and cosmetic research for developing sun protection products. Scytonemin also holds potential in pharmaceutical research due to its antioxidant, anti-inflammatory, and anticancer properties, contributing to advancements in skincare and therapeutic applications.
CAS Number | 152075-98-4 |
Synonyms | scytonemin |
Molecular Formula | C36H20N2O4 |
Purity | ≥95% |
Target | Cosmetic Research |
Storage | -20°C |
IUPAC Name | (3E)-3-[(4-hydroxyphenyl)methylidene]-1-[(3E)-3-[(4-hydroxyphenyl)methylidene]-2-oxocyclopenta[b]indol-1-yl]cyclopenta[b]indol-2-one |
InChI | InChI=1S/C36H20N2O4/c39-21-13-9-19(10-14-21)17-25-33-29(23-5-1-3-7-27(23)37-33)31(35(25)41)32-30-24-6-2-4-8-28(24)38-34(30)26(36(32)42)18-20-11-15-22(40)16-12-20/h1-18,39-40H/b25-17+,26-18+ |
InChIKey | CGZKSPLDUIRCIO-RPCRKUJJSA-N |
SMILES | C1=CC=C2C(=C1)C3=C(C(=O)C(=CC4=CC=C(C=C4)O)C3=N2)C5=C6C7=CC=CC=C7N=C6C(=CC8=CC=C(C=C8)O)C5=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |