For research use only. Not for therapeutic Use.
Seclazone, a heterocyclic compound, possesses anti-inflammatory, analgesic, antipyretic and diuretic properties. Seclazone is orally active[1].
Seclazone (220 mg/kg; p.o.; dietary, daily) inhibits the development of adjuvant-induced polyarthritis in rats[1].
Seclazone significantly lowers the fever induced in rats by administration of a yeast suspension[1].
| Catalog Number | I036176 |
| CAS Number | 29050-11-1 |
| Synonyms | 7-chloro-3,3a-dihydro-2H-[1,2]oxazolo[3,2-b][1,3]benzoxazin-9-one |
| Molecular Formula | C10H8ClNO3 |
| Purity | ≥95% |
| InChI | InChI=1S/C10H8ClNO3/c11-6-1-2-8-7(5-6)10(13)12-9(15-8)3-4-14-12/h1-2,5,9H,3-4H2 |
| InChIKey | XWXVKXXKKLBDDJ-UHFFFAOYSA-N |
| SMILES | C1CON2C1OC3=C(C2=O)C=C(C=C3)Cl |
| Reference | [1]. F M Berger, et al. The pharmacological properties of seclazone (7-chloro-3,3a-dihydro-2H, 9H-isoxazolo (3,2-b) (1,3) benzoxazin-9-one) a new anti-inflammatory agent. Pharmacology. 1973;9(3):164-76. |
