For research use only. Not for therapeutic Use.
sEH inhibitor-7（Cat No.:I042879）is a selective small molecule designed to inhibit soluble epoxide hydrolase (sEH), an enzyme involved in the metabolism of bioactive lipids. By blocking sEH, this inhibitor increases the levels of epoxy-fatty acids, which have anti-inflammatory, vasodilatory, and cardioprotective effects. The compound is being studied for its potential therapeutic applications in cardiovascular diseases, inflammation, and pain management. sEH inhibitor-7 has shown promise in preclinical models for improving endothelial function, reducing inflammation, and promoting cardiovascular health, making it a potential candidate for drug development in these therapeutic areas.
| CAS Number | 340221-20-7 |
| Synonyms | 2-cyclohexyl-N-(4-methoxyphenyl)acetamide |
| Molecular Formula | C15H21NO2 |
| Purity | ≥95% |
| IUPAC Name | 2-cyclohexyl-N-(4-methoxyphenyl)acetamide |
| InChI | InChI=1S/C15H21NO2/c1-18-14-9-7-13(8-10-14)16-15(17)11-12-5-3-2-4-6-12/h7-10,12H,2-6,11H2,1H3,(H,16,17) |
| InChIKey | SCFJMQSXUCFKPS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC(=O)CC2CCCCC2 |
