For research use only. Not for therapeutic Use.
Selenazofurin(CAT: I009425) is a nucleoside analog with antimetabolic and antineoplastic properties, widely studied in cancer and antiviral research. It inhibits inosine monophosphate dehydrogenase (IMPDH), a key enzyme in guanine nucleotide biosynthesis, leading to the disruption of DNA and RNA synthesis in rapidly dividing cells. Selenazofurin has shown potential activity against various tumor types and certain viral infections. Its unique incorporation of selenium into the nucleoside structure offers additional redox-modulating effects, enhancing its therapeutic potential. With high specificity and stability, Selenazofurin is suitable for in vitro and in vivo studies, supporting advancements in oncology and antiviral drug discovery.
| Catalog Number | I009425 |
| CAS Number | 83705-13-9 |
| Synonyms | Selenazofurin; BRN 4198668; CI-935; CI 935; CI935.;2-beta-D-Ribofuranosyl-4-selenazolecarboxamide |
| Molecular Formula | C9H12N2O5Se |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-selenazole-4-carboxamide |
| InChI | InChI=1S/C9H12N2O5Se/c10-8(15)3-2-17-9(11-3)7-6(14)5(13)4(1-12)16-7/h2,4-7,12-14H,1H2,(H2,10,15)/t4-,5-,6-,7-/m1/s1 |
| InChIKey | CKMBACZHCFMPLQ-DBRKOABJSA-N |
| SMILES | C1=C(N=C([Se]1)C2C(C(C(O2)CO)O)O)C(=O)N |
