For research use only. Not for therapeutic Use.
Seltorexant is a novel orexin receptor antagonist, specifically targeting the orexin-2 receptor (OX2R). It is being developed for the treatment of insomnia and major depressive disorder (MDD). By selectively blocking OX2R, seltorexant reduces wakefulness and promotes sleep without the sedative side effects associated with traditional sleep aids. Additionally, it has shown potential in alleviating depressive symptoms, particularly in patients with insomnia-related MDD. Seltorexant is promising for its dual therapeutic benefits in improving sleep and mood regulation.
| Catalog Number | I009428 |
| CAS Number | 1293281-49-8 |
| Synonyms | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(triazol-2-yl)phenyl]methanone |
| Molecular Formula | C21H22FN7O |
| Purity | ≥95% |
| InChI | InChI=1S/C21H22FN7O/c1-13-8-14(2)26-21(25-13)28-11-15-9-27(10-16(15)12-28)20(30)19-17(22)4-3-5-18(19)29-23-6-7-24-29/h3-8,15-16H,9-12H2,1-2H3 |
| InChIKey | SQOCEMCKYDVLMM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N2CC3CN(CC3C2)C(=O)C4=C(C=CC=C4F)N5N=CC=N5)C |
