For research use only. Not for therapeutic Use.
Selvigaltin（Cat No.:I043534）is a novel, investigational compound that functions as an inhibitor of the sodium-glucose cotransporter 2 (SGLT2). By inhibiting SGLT2, Selvigaltin helps to reduce glucose reabsorption in the kidneys, leading to increased urinary glucose excretion and lower blood glucose levels. This mechanism makes it a potential therapeutic candidate for treating type 2 diabetes and potentially other metabolic disorders, as it aids in better glucose management. Selvigaltin is being studied for its effectiveness, safety, and impact on long-term diabetes management, particularly for patients with poor glycemic control.
| CAS Number | 1978336-95-6 |
| Synonyms | (2R,3R,4S,5R,6R)-2-(5-bromopyridin-3-yl)sulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| Molecular Formula | C19H16BrF3N4O4S |
| Purity | ≥95% |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(5-bromopyridin-3-yl)sulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| InChI | InChI=1S/C19H16BrF3N4O4S/c20-9-3-10(5-24-4-9)32-19-18(30)16(17(29)14(7-28)31-19)27-6-13(25-26-27)8-1-11(21)15(23)12(22)2-8/h1-6,14,16-19,28-30H,7H2/t14-,16+,17+,18-,19-/m1/s1 |
| InChIKey | FNCLKJPMEFPXOR-QFACEVIFSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C2=CN(N=N2)[C@H]3[C@H]([C@H](O[C@@H]([C@@H]3O)SC4=CC(=CN=C4)Br)CO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
