For research use only. Not for therapeutic Use.
Semax (Cat No.:I036207) is a synthetic peptide derived from the adrenocorticotropic hormone (ACTH) fragment. It has gained attention for its potential nootropic and neuroprotective effects. Semax is known for its ability to enhance cognitive functions, improve memory, and increase focus and attention. It also exhibits anti-inflammatory properties and may have a positive impact on mood and emotional well-being. Although more research is needed, Semax shows promise as a potential therapeutic agent for neurological disorders and cognitive enhancement.
| Catalog Number | I036207 |
| CAS Number | 80714-61-0 |
| Synonyms | Semax |
| Molecular Formula | C37H51N9O10S |
| Purity | 98% |
| Target | Peptides |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | -20°C |
| IUPAC Name | L-methionyl-L-α-glutamyl-L-histidyl-L-phenylalanyl-L-prolylglycyl-L-proline |
| InChI | InChI=1S/C37H51N9O10S/c1-57-16-13-24(38)32(50)42-25(11-12-31(48)49)33(51)43-26(18-23-19-39-21-41-23)34(52)44-27(17-22-7-3-2-4-8-22)36(54)46-15-5-9-28(46)35(53)40-20-30(47)45-14-6-10-29(45)37(55)56/h2-4,7-8,19,21,24-29H,5-6,9-18,20,38H2,1H3,(H,39,41)(H,40,53)(H,42,50)(H,43,51)(H,44,52)(H,48,49)(H,55,56)/t24-,25-,26-,27-,28-,29-/m0/s1 |
| InChIKey | AFEHBIGDWIGTEH-AQRCPPRCSA-N |
| SMILES | O=C(O)[C@H]1N(C(CNC([C@H]2N(C([C@H](CC3=CC=CC=C3)NC([C@H](CC4=CNC=N4)NC([C@H](CCC(O)=O)NC([C@H](CCSC)N)=O)=O)=O)=O)CCC2)=O)=O)CCC1 |
| Reference | 1. Bashkatova, V.G., Koshelev, V.B., Fadyukova, O.E., et al. Novel synthetic analogue of ACTH 4-10 (Semax) but not glycine prevents the enhanced nitric oxide generation in cerebral cortex of rats with incomplete global ischemia. Brain Res. 894(1), 145-149 (2001). |
