For research use only. Not for therapeutic Use.
SEMBL(CAT: I036208) is a potent NF-κB inhibitor with significant applications in anticancer research. It effectively blocks NF-κB-DNA binding and suppresses NF-κB-dependent inflammatory cytokine secretion. SEMBL also inhibits cancer cell migration and invasion by downregulating matrix metalloproteinase (MMP) expression, particularly MMP-2. In ovarian carcinoma cells, SEMBL reduces metastatic activity and inhibits constitutively activated NF-κB activity at non-toxic concentrations. These properties make SEMBL a valuable tool for studying cancer cell behavior, including migration, invasion, and inflammation-related mechanisms, offering potential insights into therapeutic strategies targeting NF-κB and cancer metastasis.
| Catalog Number | I036208 |
| CAS Number | 1443448-82-5 |
| Synonyms | 2-hydroxy-N-[(3S)-4-methylidene-5-oxooxolan-3-yl]benzamide |
| Molecular Formula | C12H11NO4 |
| Purity | ≥95% |
| IUPAC Name | 2-hydroxy-N-[(3S)-4-methylidene-5-oxooxolan-3-yl]benzamide |
| InChI | InChI=1S/C12H11NO4/c1-7-9(6-17-12(7)16)13-11(15)8-4-2-3-5-10(8)14/h2-5,9,14H,1,6H2,(H,13,15)/t9-/m1/s1 |
| InChIKey | SBEBFCLNXGMFOQ-SECBINFHSA-N |
| SMILES | C=C1C(COC1=O)NC(=O)C2=CC=CC=C2O |
| Reference | [1]. Umezawa K, et al. Inhibition of matrix metalloproteinase expression and cellular invasion by NF-κB inhibitors of microbial origin. Biochim Biophys Acta Proteins Proteom. 2020;1868(6):140412. |
