For research use only. Not for therapeutic Use.
Seneganolide (compound 1) is isolated from the stem bark of Khaya senegalensis. Seneganolide can be used as insect antifeedant[1].
| Catalog Number | R020173 |
| CAS Number | 301530-12-1 |
| Synonyms | (1S,2R,6R,7R,10R,11S,16S,19S,20S)-6-(furan-3-yl)-20-hydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.01,10.02,7.011,16.011,20]docosane-4,14,18-trione |
| Molecular Formula | C26H30O8 |
| Purity | ≥95% |
| InChI | InChI=1S/C26H30O8/c1-22(2)16-8-18(27)32-12-24(16)15-4-6-23(3)17(9-19(28)33-21(23)13-5-7-31-11-13)25(15)10-14(20(22)29)26(24,30)34-25/h5,7,11,14-17,21,30H,4,6,8-10,12H2,1-3H3/t14-,15+,16-,17+,21-,23+,24+,25+,26-/m0/s1 |
| InChIKey | VIOKSDWKSSMHBF-MQELVVIJSA-N |
| SMILES | CC1(C2CC(=O)OCC23C4CCC5(C(C46CC(C1=O)C3(O6)O)CC(=O)OC5C7=COC=C7)C)C |
| Reference | [1]. Munehiro Nakatani, et al. Seneganolide, a Novel Antifeeding Mexicanolide from Khaya senegalensis. Chemistry Letters. 2000, 29, 8. |
