For research use only. Not for therapeutic Use.
Senkyunolide I(Cat No.:R064388) is a natural compound found in certain plants, particularly in the genus Ligusticum (Umbelliferae). Its mode of action involves being a bioactive compound with potential pharmacological activities. Pharmacologically, Senkyunolide I has been studied for various effects, including anti-inflammatory, neuroprotective, and analgesic properties. It has shown promise in preclinical studies, demonstrating its potential as a natural anti-inflammatory agent, its ability to protect neurons from damage, and its potential as an analgesic to alleviate pain.
CAS Number | 94596-28-8 |
Molecular Formula | C12H16O4 |
Purity | ≥95% |
Target | Caspase |
Storage | -20°C |
IUPAC Name | (3Z,6S,7S)-3-butylidene-6,7-dihydroxy-4,5,6,7-tetrahydro-2-benzofuran-1-one |
InChI | InChI=1S/C12H16O4/c1-2-3-4-9-7-5-6-8(13)11(14)10(7)12(15)16-9/h4,8,11,13-14H,2-3,5-6H2,1H3/b9-4-/t8-,11+/m0/s1 |
InChIKey | DQNGMIQSXNGHOA-JXQVETIVSA-N |
SMILES | CCC/C=C\1/C2=C([C@@H]([C@H](CC2)O)O)C(=O)O1 |