For research use only. Not for therapeutic Use.
Sennidin B(Cat No.:R072716)is a natural dianthrone compound derived from senna plants, recognized for its significant biological activities. It is primarily studied for its role as a laxative, aiding in gastrointestinal motility by stimulating the colon’s smooth muscles. Additionally, Sennidin B exhibits potential antioxidant and anti-inflammatory properties, making it a subject of interest in pharmaceutical and nutraceutical research. Its ability to modulate cellular pathways suggests broader therapeutic applications, including its exploration in metabolic and chronic inflammatory conditions. Sennidin B serves as a valuable tool in natural product and pharmacological studies.
CAS Number | 517-44-2 |
Molecular Formula | C30H18O10 |
Purity | ≥95% |
Target | PI3K/Akt/mTOR |
IUPAC Name | (9S)-9-[(9R)-2-carboxy-4,5-dihydroxy-10-oxo-9H-anthracen-9-yl]-4,5-dihydroxy-10-oxo-9H-anthracene-2-carboxylic acid |
InChI | InChI=1S/C30H18O10/c31-17-5-1-3-13-21(15-7-11(29(37)38)9-19(33)25(15)27(35)23(13)17)22-14-4-2-6-18(32)24(14)28(36)26-16(22)8-12(30(39)40)10-20(26)34/h1-10,21-22,31-34H,(H,37,38)(H,39,40)/t21-,22+ |
InChIKey | JPMRHWLJLNKRTJ-SZPZYZBQSA-N |
SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C([C@@H]2[C@H]4C5=C(C(=CC=C5)O)C(=O)C6=C4C=C(C=C6O)C(=O)O)C=C(C=C3O)C(=O)O |