For research use only. Not for therapeutic Use.
Sepimostat(Cat No.:M013355)is a potent serine protease inhibitor used primarily in research and therapeutic applications to regulate proteolytic activity. By inhibiting specific proteases, sepimostat helps control inflammatory responses and coagulation processes. Its mechanism of action involves binding to the active site of target enzymes, preventing substrate interaction and subsequent proteolysis. This inhibition is crucial in studying diseases characterized by excessive protease activity, such as pancreatitis, and in developing treatments for related conditions. Sepimostat’s specificity and efficacy make it a valuable tool in both clinical research and potential therapeutic interventions.
CAS Number | 103926-64-3 |
Synonyms | (6-carbamimidoylnaphthalen-2-yl) 4-(4,5-dihydro-1H-imidazol-2-ylamino)benzoate |
Molecular Formula | C21H19N5O2 |
Purity | ≥95% |
IUPAC Name | (6-carbamimidoylnaphthalen-2-yl) 4-(4,5-dihydro-1H-imidazol-2-ylamino)benzoate |
InChI | InChI=1S/C21H19N5O2/c22-19(23)16-2-1-15-12-18(8-5-14(15)11-16)28-20(27)13-3-6-17(7-4-13)26-21-24-9-10-25-21/h1-8,11-12H,9-10H2,(H3,22,23)(H2,24,25,26) |
InChIKey | QMRJOIUGPCVZPH-UHFFFAOYSA-N |
SMILES | C1CN=C(N1)NC2=CC=C(C=C2)C(=O)OC3=CC4=C(C=C3)C=C(C=C4)C(=N)N |