For research use only. Not for therapeutic Use.
Serotonin glucuronide is the product of Serotonin glucuronidation[1].
| Catalog Number | R052071 |
| CAS Number | 18186-43-1 |
| Synonyms | (2S,3S,4S,5R,6S)-6-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Molecular Formula | C16H20N2O7 |
| Purity | ≥95% |
| InChI | InChI=1S/C16H20N2O7/c17-4-3-7-6-18-10-2-1-8(5-9(7)10)24-16-13(21)11(19)12(20)14(25-16)15(22)23/h1-2,5-6,11-14,16,18-21H,3-4,17H2,(H,22,23)/t11-,12-,13+,14-,16+/m0/s1 |
| InChIKey | QALKNDMLQRCLGT-JHZZJYKESA-N |
| SMILES | C1=CC2=C(C=C1OC3C(C(C(C(O3)C(=O)O)O)O)O)C(=CN2)CCN |
| Reference | [1]. Krishnaswamy S, et al. Serotonin (5-hydroxytryptamine) glucuronidation in vitro: assay development, human liver microsome activities and species differences. Xenobiotica. 2003 Feb;33(2):169-80. |
