For research use only. Not for therapeutic Use.
Serotonin HCl (Cat No.:A001069) is a monoamine neurotransmitter and endogenous 5-HT receptor agonist. 5-HT acts primarily as a neurotransmitter and is involved in a wide range of physiological functions in the body, including the regulation of memory, cognition, emotion, learning, and addiction in the brain.
| Catalog Number | A001069 |
| CAS Number | 153-98-0 |
| Synonyms | 5-HT HCl |
| Molecular Formula | C10H13ClN2O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol;hydrochloride |
| InChI | InChI=1S/C10H12N2O.ClH/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10;/h1-2,5-6,12-13H,3-4,11H2;1H |
| InChIKey | MDIGAZPGKJFIAH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=CN2)CCN.Cl |
