For research use only. Not for therapeutic Use.
Serotonin HCl (CAT: A001069) is a salt form of serotonin (5-hydroxytryptamine, 5-HT), a key neurotransmitter involved in regulating mood, sleep, appetite, and various physiological processes. It acts by binding to and activating serotonin receptors, which are widely distributed in the central and peripheral nervous systems. Serotonin HCl is commonly used in neuropharmacology research to study serotonin-mediated signaling pathways and their roles in disorders such as depression, anxiety, and gastrointestinal diseases. Additionally, it is employed to explore receptor interactions, neurotransmitter release, and the development of serotonin-targeted therapeutics.
CAS Number | 153-98-0 |
Synonyms | 5-HT HCl |
Molecular Formula | C10H13ClN2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol;hydrochloride |
InChI | InChI=1S/C10H12N2O.ClH/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10;/h1-2,5-6,12-13H,3-4,11H2;1H |
InChIKey | MDIGAZPGKJFIAH-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1O)C(=CN2)CCN.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |