For research use only. Not for therapeutic Use.
Serricornin is a pheromone compound produced by certain beetle species, essential for advanced entomological and biochemical research. This compound plays a crucial role in studying insect behavior, mating patterns, and pest control strategies. Its unique properties enable detailed analysis of pheromone communication and ecological interactions. Serricornin is highly valued for its purity and effectiveness, making it an indispensable tool for researchers developing environmentally friendly pest management solutions and enhancing our understanding of insect ecology.
| Catalog Number | R006569 |
| CAS Number | 72522-40-8 |
| Synonyms | 4,6-Dimethyl-7-hydroxy-nonan-3-one |
| Molecular Formula | C11H22O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 7-hydroxy-4,6-dimethylnonan-3-one |
| InChI | InChI=1S/C11H22O2/c1-5-10(12)8(3)7-9(4)11(13)6-2/h8-10,12H,5-7H2,1-4H3 |
| InChIKey | YEKDTNYNLCQHPV-UHFFFAOYSA-N |
| SMILES | CCC(C(C)CC(C)C(=O)CC)O |
