For research use only. Not for therapeutic Use.
Sertaconazole(Cat No.:R064932) is an antifungal medication belonging to the imidazole class. Its mode of action involves being a broad-spectrum antifungal agent effective against various fungi, including dermatophytes, yeasts, and molds. Sertaconazole works by inhibiting the synthesis of ergosterol, a key component of fungal cell membranes, leading to disruption and subsequent death of the fungal cells. Due to its potent antifungal properties, Sertaconazole is commonly used in topical formulations, such as creams or ointments, for the treatment of skin infections like tinea (ringworm) and candidiasis.
CAS Number | 99592-32-2 |
Molecular Formula | C20H15Cl3N2OS |
Purity | ≥95% |
Target | Autophagy |
Storage | Store at -20°C |
IUPAC Name | 1-[2-[(7-chloro-1-benzothiophen-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole |
InChI | InChI=1S/C20H15Cl3N2OS/c21-14-4-5-16(18(23)8-14)19(9-25-7-6-24-12-25)26-10-13-11-27-20-15(13)2-1-3-17(20)22/h1-8,11-12,19H,9-10H2 |
InChIKey | JLGKQTAYUIMGRK-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=C1)Cl)SC=C2COC(CN3C=CN=C3)C4=C(C=C(C=C4)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |