For research use only. Not for therapeutic Use.
Sethoxydim(Cat No.:R069692), is a selective herbicide used in agriculture to control grassy weeds in various crops, particularly in grass crops like wheat, barley, oats, and turf. It belongs to the chemical class of cyclohexanediones and works by inhibiting the growth of grassy weeds while allowing broadleaf crops to flourish. Sethoxydim interferes with the plant’s lipid metabolism, leading to the death of target grassy weeds.
Catalog Number | R069692 |
CAS Number | 74051-80-2 |
Molecular Formula | C17H29NO3S |
Purity | ≥95% |
Target | Acetyl-CoA Carboxylase |
Storage | 2-8°C |
IUPAC Name | 2-[1-(ethoxyamino)butylidene]-5-(2-ethylsulfanylpropyl)cyclohexane-1,3-dione |
InChI | InChI=1S/C17H29NO3S/c1-5-8-14(18-21-6-2)17-15(19)10-13(11-16(17)20)9-12(4)22-7-3/h12-13,18H,5-11H2,1-4H3 |
InChIKey | JEFHGYSGNIFAEY-UHFFFAOYSA-N |
SMILES | CCCC(=C1C(=O)CC(CC1=O)CC(C)SCC)NOCC |