For research use only. Not for therapeutic Use.
SF2312（Cat No.:I036257）is a small molecule compound under investigation for its potential use in cancer therapy. It functions as an inhibitor of specific kinases involved in cell cycle regulation and cancer cell proliferation. By targeting these kinases, SF2312 disrupts key signaling pathways that support tumor growth and survival. This compound has shown promise in preclinical studies, particularly in cancers with altered kinase activity. SF2312 is being explored for its potential to overcome resistance to other cancer therapies, offering a new avenue for treating various malignancies, including those resistant to traditional treatments.
| CAS Number | 107729-45-3 |
| Synonyms | (1,5-dihydroxy-2-oxopyrrolidin-3-yl)phosphonic acid |
| Molecular Formula | C4H8NO6P |
| Purity | ≥95% |
| IUPAC Name | (1,5-dihydroxy-2-oxopyrrolidin-3-yl)phosphonic acid |
| InChI | InChI=1S/C4H8NO6P/c6-3-1-2(12(9,10)11)4(7)5(3)8/h2-3,6,8H,1H2,(H2,9,10,11) |
| InChIKey | CGWBGDOPBYWJKZ-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)N(C1O)O)P(=O)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
