For research use only. Not for therapeutic Use.
SGC 707(Cat No.:I011178)is an investigational small molecule designed as a selective inhibitor of the protein phosphatase 2A (PP2A), an enzyme that regulates several key cellular processes, including cell growth, survival, and apoptosis. By modulating PP2A activity, SGC 707 has shown potential in oncology, as it may alter cancer cell signaling pathways, potentially leading to reduced tumor growth and improved response to other treatments. It is being studied for its therapeutic applications in various cancers, with ongoing clinical trials evaluating its safety, efficacy, pharmacokinetics, and potential combination with other cancer therapies.
CAS Number | 1687736-54-4 |
Synonyms | 1-(Isoquinolin-6-yl)-3-[2-oxo-2-(pyrrolidin-1-yl)ethyl] urea |
Molecular Formula | C16H18N4O2 |
Purity | ≥95% |
Solubility | Soluble to 100 mM in 1eq. HCl and to 100 mM in DMSO |
Storage | Store at +4C |
IUPAC Name | 1-isoquinolin-6-yl-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea |
InChI | InChI=1S/C16H18N4O2/c21-15(20-7-1-2-8-20)11-18-16(22)19-14-4-3-13-10-17-6-5-12(13)9-14/h3-6,9-10H,1-2,7-8,11H2,(H2,18,19,22) |
InChIKey | DMIDPTCQPIJYFE-UHFFFAOYSA-N |
SMILES | C1CCN(C1)C(=O)CNC(=O)NC2=CC3=C(C=C2)C=NC=C3 |