For research use only. Not for therapeutic Use.
SGI-1776 (Cat.No:I000164) is a small molecule inhibitor that targets the enzyme Pim kinase. Pim kinases play a role in promoting cell survival and proliferation in cancer cells. SGI-1776 has shown potential in preclinical studies as an anticancer agent, inhibiting tumor growth and enhancing the efficacy of chemotherapy in certain cancer types.
| Catalog Number | I000164 |
| CAS Number | 1025065-69-3 |
| Synonyms | N-[(1-methylpiperidin-4-yl)methyl]-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine |
| Molecular Formula | C₂₀H₂₂F₃N₅O |
| Purity | ≥95% |
| Target | Pim |
| Solubility | 10 mM in DMSO |
| Storage | -20℃ |
| IC50 | 7 nM |
| IUPAC Name | N-[(1-methylpiperidin-4-yl)methyl]-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine |
| InChI | InChI=1S/C20H22F3N5O/c1-27-9-7-14(8-10-27)12-24-18-5-6-19-25-13-17(28(19)26-18)15-3-2-4-16(11-15)29-20(21,22)23/h2-6,11,13-14H,7-10,12H2,1H3,(H,24,26) |
| InChIKey | MHXGEROHKGDZGO-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)CNC2=NN3C(=NC=C3C4=CC(=CC=C4)OC(F)(F)F)C=C2 |
