For research use only. Not for therapeutic Use.
SH-053-R-CH3-2’F(Cat No.:I012229)is a selective, high-affinity compound that acts as a positive allosteric modulator of the metabotropic glutamate receptor 2 (mGluR2). By enhancing the activity of mGluR2, it modulates glutamate signaling, which plays a critical role in various neurological processes, including synaptic plasticity, learning, and memory. This compound has shown potential in preclinical studies for the treatment of psychiatric and neurological disorders, such as anxiety, schizophrenia, and depression, by stabilizing excitatory neurotransmission and potentially improving cognitive function without causing significant side effects.
CAS Number | 872874-14-1 |
Synonyms | (4R)-8-Ethynyl-6-(2-fluorophenyl)-4-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
Molecular Formula | C23H18FN3O2 |
Purity | ≥95% |
IUPAC Name | ethyl (4R)-8-ethynyl-6-(2-fluorophenyl)-4-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
InChI | InChI=1S/C23H18FN3O2/c1-4-15-10-11-19-17(12-15)20(16-8-6-7-9-18(16)24)26-14(3)22-21(23(28)29-5-2)25-13-27(19)22/h1,6-14H,5H2,2-3H3/t14-/m1/s1 |
InChIKey | NGYKELBMVXBFSM-CQSZACIVSA-N |
SMILES | CCOC(=O)C1=C2[C@H](N=C(C3=C(N2C=N1)C=CC(=C3)C#C)C4=CC=CC=C4F)C |