For research use only. Not for therapeutic Use.
Shikonin (CAT: I003868) is a naturally occurring naphthoquinone compound derived from the roots of the plant Lithospermum erythrorhizon. It possesses various pharmacological activities, including anti-inflammatory, antioxidant, antimicrobial, and anticancer properties. Shikonin has been traditionally used in traditional Chinese medicine for its wound healing and anti-inflammatory effects. It has shown promising potential as an anticancer agent, exhibiting inhibitory effects on various cancer cell lines and tumor growth. Shikonin’s mechanism of action involves the modulation of multiple signaling pathways, including apoptosis, cell cycle regulation, and inflammation. Furthermore, it has been investigated for its potential therapeutic applications in dermatological disorders and microbial infections.
| Catalog Number | I003868 |
| CAS Number | 517-89-5 |
| Synonyms | C.I. 75535;Isoarnebin 4;NSC 252844 |
| Molecular Formula | C₁₆H₁₆O₅ |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | DMSO ≥ 31 mg/mL |
| Storage | -20°C |
| IUPAC Name | 5,8-dihydroxy-2-[(1R)-1-hydroxy-4-methylpent-3-enyl]naphthalene-1,4-dione |
| InChI | InChI=1S/C16H16O5/c1-8(2)3-4-10(17)9-7-13(20)14-11(18)5-6-12(19)15(14)16(9)21/h3,5-7,10,17-19H,4H2,1-2H3 |
| InChIKey | NEZONWMXZKDMKF-UHFFFAOYSA-N |
| SMILES | CC(=CCC(C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)O)C |
