For research use only. Not for therapeutic Use.
Shz-1, a small cardiogenic molecule, induces various cardiac-specific genes including sarcomeric tropomyosin in P19CL6 cells. Shz-1 induces Nkx2.5 expression in mouse. Shz-1 activates the axolotl TPM4 promoter-driven ectopic expression in C2C12 cells[1].
| Catalog Number | R021930 |
| CAS Number | 326886-05-9 |
| Synonyms | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]benzenesulfonamide |
| Molecular Formula | C13H11BrN2O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C13H11BrN2O3S/c14-11-6-7-13(17)10(8-11)9-15-16-20(18,19)12-4-2-1-3-5-12/h1-9,16-17H/b15-9+ |
| InChIKey | OEMCLQLAWYKPRK-OQLLNIDSSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NN=CC2=C(C=CC(=C2)Br)O |
| Reference | [1]. Changlong Nan, et al. Expression of sarcomeric tropomyosin in striated muscles in axolotl treated with shz-1, a small cardiogenic molecule. Cardiovasc Toxicol. 2015 Jan;15(1):29-40. |
