For research use only. Not for therapeutic Use.
SID 3712249（Cat No.:I003907）is a selective inhibitor of the histone methyltransferase G9a, which plays a crucial role in the methylation of histone H3 at lysine 9 (H3K9me2/3). By inhibiting G9a, SID 3712249 can reactivate silenced tumor suppressor genes and disrupt oncogenic signaling pathways associated with various cancers. This compound has shown potential in preclinical studies for its anti-cancer effects, particularly in tumors with elevated G9a activity. SID 3712249’s unique mechanism of action makes it a promising candidate for developing targeted therapies aimed at reversing epigenetic modifications in cancer treatment.
| Catalog Number | I003907 |
| CAS Number | 522606-67-3 |
| Molecular Formula | C17H21N7 |
| Purity | ≥95% |
| Target | MiR-544 |
| Solubility | DMSO: ≥ 30 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 1,8-diamino-3,6-dipyrrolidin-1-yl-2,7-naphthyridine-4-carbonitrile |
| InChI | InChI=1S/C17H21N7/c18-10-12-11-9-13(23-5-1-2-6-23)21-15(19)14(11)16(20)22-17(12)24-7-3-4-8-24/h9H,1-8H2,(H2,19,21)(H2,20,22) |
| InChIKey | SSWVPYMSHHEYAB-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=NC(=C3C(=C2)C(=C(N=C3N)N4CCCC4)C#N)N |
| Reference | <p style=/line-height:25px/> |
