For research use only. Not for therapeutic Use.
SID-852843(Cat No.:I012464)is a small molecule compound currently being researched for its potential therapeutic applications, particularly in oncology. It is designed to target specific pathways or enzymes involved in cancer cell proliferation, survival, or resistance to treatment. SID-852843 has shown promise in preclinical studies for its ability to inhibit tumor growth and enhance the effectiveness of other cancer therapies. Ongoing studies are focused on evaluating its pharmacokinetics, safety, and efficacy in clinical trials, with the goal of developing it as a potential treatment for various cancers or other diseases driven by abnormal cell growth.
CAS Number | 909859-19-4 |
Synonyms | [5-amino-1-(4-methoxyphenyl)sulfonylpyrazol-3-yl] benzoate |
Molecular Formula | C17H15N3O5S |
Purity | ≥95% |
IUPAC Name | [5-amino-1-(4-methoxyphenyl)sulfonylpyrazol-3-yl] benzoate |
InChI | InChI=1S/C17H15N3O5S/c1-24-13-7-9-14(10-8-13)26(22,23)20-15(18)11-16(19-20)25-17(21)12-5-3-2-4-6-12/h2-11H,18H2,1H3 |
InChIKey | FQICFDBMQBCJDT-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)S(=O)(=O)N2C(=CC(=N2)OC(=O)C3=CC=CC=C3)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |