For research use only. Not for therapeutic Use.
Siglazodan（Cat No.:M016962）, is a chemical compound originally developed as a potential treatment for various cardiovascular disorders, including congestive heart failure. It acts as a vasodilator and inotropic agent, which means it can relax blood vessels and enhance the heart’s pumping ability. However, clinical development for these cardiac indications was halted due to safety concerns.
| Catalog Number | M016962 |
| CAS Number | 115344-47-3 |
| Synonyms | A name could not be generated for this structure. |
| Molecular Formula | C14H16N6O |
| Purity | ≥95% |
| Target | Phosphodiesterase (PDE) |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | 2-8°C |
| IUPAC Name | 1-cyano-2-methyl-3-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]guanidine |
| InChI | InChI=1S/C14H16N6O/c1-9-7-12(21)19-20-13(9)10-3-5-11(6-4-10)18-14(16-2)17-8-15/h3-6,9H,7H2,1-2H3,(H,19,21)(H2,16,17,18) |
| InChIKey | NUHPODZZKHQQET-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)NN=C1C2=CC=C(C=C2)NC(=NC)NC#N |
