For research use only. Not for therapeutic Use.
Silibinin (CAT: I002745) is a natural flavonoid compound derived from milk thistle seeds (Silybum marianum). It exhibits hepatoprotective effects and is commonly used as a dietary supplement. Silibinin has antioxidant, anti-inflammatory, and anti-fibrotic activities, making it useful for protecting the liver against damage from toxins, drugs, and alcohol. It also shows potential as an anticancer agent, inhibiting tumor growth and inducing cancer cell apoptosis. Silibinin has been investigated for its therapeutic applications in liver disorders, cancer, diabetes, neurodegenerative diseases, and skin disorders.
| CAS Number | 22888-70-6 |
| Synonyms | Silibinin A;Silymarin I |
| Molecular Formula | C25H22O10 |
| Purity | ≥95% |
| Target | NF-κB |
| Solubility | DMSO: ≥ 31 mg/mL |
| Storage | store at -20℃ |
| IUPAC Name | (2R,3R)-3,5,7-trihydroxy-2-[(2R,3R)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydrochromen-4-one |
| InChI | 1S/C25H22O10/c1-32-17-6-11(2-4-14(17)28)24-20(10-26)33-16-5-3-12(7-18(16)34-24)25-23(31)22(30)21-15(29)8-13(27)9-19(21)35-25/h2-9,20,23-29,31H,10H2,1H3/t20-,23+,24-,25-/m1/s1 |
| InChIKey | SEBFKMXJBCUCAI-HKTJVKLFSA-N |
| SMILES | COC1=C(C=CC(=C1)[C@@H]2[C@H](OC3=C(O2)C=C(C=C3)[C@@H]4[C@H](C(=O)C5=C(C=C(C=C5O4)O)O)O)CO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
